About (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane
(2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane (PubChem CID 92860765) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane.
Molecular Properties
| Compound Name | (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane |
| PubChem CID | 92860765 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane |
| SMILES | CC(C)[C@@H]1CO[C@@H](C)SC1 |
| InChI | InChI=1S/C8H16OS/c1-6(2)8-4-9-7(3)10-5-8/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | JSHXMLHPTWVJRP-HTQZYQBOSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane?
The IUPAC name of (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane (CID 92860765) is (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane.
What is the SMILES notation for (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane?
The canonical SMILES for (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane is CC(C)[C@@H]1CO[C@@H](C)SC1.
What is the InChIKey of (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane?
The InChIKey is JSHXMLHPTWVJRP-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H16OS/c1-6(2)8-4-9-7(3)10-5-8/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane?
(2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane has a molecular weight of 160.28 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2-methyl-5-propan-2-yl-1,3-oxathiane is sourced from PubChem (CID 92860765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).