C17H33N3O — CID 92861415
(6S)-2,6-dimethyl-8-[3-(2-methylimidazol-1-yl)propylamino]octan-2-ol (PubChem CID 92861415) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is (6S)-2,6-dimethyl-8-[3-(2-methylimidazol-1-yl)propylamino]octan-2-ol.
| Compound Name | (6S)-2,6-dimethyl-8-[3-(2-methylimidazol-1-yl)propylamino]octan-2-ol |
|---|---|
| PubChem CID | 92861415 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | (6S)-2,6-dimethyl-8-[3-(2-methylimidazol-1-yl)propylamino]octan-2-ol |
| SMILES | Cc1nccn1CCCNCC[C@@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C17H33N3O/c1-15(7-5-9-17(3,4)21)8-11-18-10-6-13-20-14-12-19-16(20)2/h12,14-15,18,21H,5-11,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | SAFBJMPFHZSTAL-HNNXBMFYSA-N |
| XLogP | 3.14 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|