C14H16F3N3O4 — CID 9286444
methyl N-[2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetyl]carbamate (PubChem CID 9286444) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is methyl N-[2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetyl]carbamate.
| Compound Name | methyl N-[2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetyl]carbamate |
|---|---|
| PubChem CID | 9286444 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | methyl N-[2-[methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]amino]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN(C)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O4/c1-20(8-12(22)19-13(23)24-2)7-11(21)18-10-6-4-3-5-9(10)14(15,16)17/h3-6H,7-8H2,1-2H3,(H,18,21)(H,19,22,23) |
| InChIKey | INHOEOSUYVVUHG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |