About (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile
(7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile (PubChem CID 92867606) has the molecular formula C22H15ClN2O2
and a molecular weight of 374.83 g/mol. Its IUPAC name is (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile |
| PubChem CID | 92867606 |
| Molecular Formula | C22H15ClN2O2 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(n(-c3ccc(Cl)cc3)c1=O)C[C@@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C22H15ClN2O2/c23-17-6-8-18(9-7-17)25-20-11-15(14-4-2-1-3-5-14)12-21(26)19(20)10-16(13-24)22(25)27/h1-10,15H,11-12H2/t15-/m1/s1 |
| InChIKey | MNGAIEVHTNUZMQ-OAHLLOKOSA-N |
| XLogP | 4.28 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile?
The IUPAC name of (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile (CID 92867606) is (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile.
What is the SMILES notation for (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile?
The canonical SMILES for (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile is N#Cc1cc2c(n(-c3ccc(Cl)cc3)c1=O)C[C@@H](c1ccccc1)CC2=O.
What is the InChIKey of (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile?
The InChIKey is MNGAIEVHTNUZMQ-OAHLLOKOSA-N. The full InChI is InChI=1S/C22H15ClN2O2/c23-17-6-8-18(9-7-17)25-20-11-15(14-4-2-1-3-5-14)12-21(26)19(20)10-16(13-24)22(25)27/h1-10,15H,11-12H2/t15-/m1/s1.
What are the key properties of (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile?
(7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile has a molecular weight of 374.83 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-1-(4-chlorophenyl)-2,5-dioxo-7-phenyl-7,8-dihydro-6H-quinoline-3-carbonitrile is sourced from PubChem (CID 92867606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).