C24H23N5O2S — CID 92868365
2-[(6S)-3-butylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzonitrile (PubChem CID 92868365) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-[(6S)-3-butylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzonitrile.
| Compound Name | 2-[(6S)-3-butylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 92868365 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[(6S)-3-butylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzonitrile |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1ccccc1C#N)N(C(=O)CC)c1ccccc1-2 |
| InChI | InChI=1S/C24H23N5O2S/c1-3-5-14-32-24-26-22-21(27-28-24)18-12-8-9-13-19(18)29(20(30)4-2)23(31-22)17-11-7-6-10-16(17)15-25/h6-13,23H,3-5,14H2,1-2H3/t23-/m0/s1 |
| InChIKey | HNKVCEJYWCIEKT-QHCPKHFHSA-N |
| XLogP | 5.14 |
| TPSA | 92.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|