C27H32N4O2S — CID 92868865
1-[(6R)-6-(3,4-dimethylphenyl)-8,10-dimethyl-3-(2-methylpropylsulfanyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one (PubChem CID 92868865) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is 1-[(6R)-6-(3,4-dimethylphenyl)-8,10-dimethyl-3-(2-methylpropylsulfanyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one.
| Compound Name | 1-[(6R)-6-(3,4-dimethylphenyl)-8,10-dimethyl-3-(2-methylpropylsulfanyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 92868865 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-[(6R)-6-(3,4-dimethylphenyl)-8,10-dimethyl-3-(2-methylpropylsulfanyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
| SMILES | CCC(=O)N1c2c(C)cc(C)cc2-c2nnc(SCC(C)C)nc2O[C@@H]1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H32N4O2S/c1-8-22(32)31-24-19(7)11-16(4)12-21(24)23-25(28-27(30-29-23)34-14-15(2)3)33-26(31)20-10-9-17(5)18(6)13-20/h9-13,15,26H,8,14H2,1-7H3/t26-/m1/s1 |
| InChIKey | UWVZTTOXTHUWME-AREMUKBSSA-N |
| XLogP | 6.35 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |