C26H30N4O2S — CID 92868891
1-[(6S)-3-butylsulfanyl-6-(2,5-dimethylphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone (PubChem CID 92868891) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is 1-[(6S)-3-butylsulfanyl-6-(2,5-dimethylphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone.
| Compound Name | 1-[(6S)-3-butylsulfanyl-6-(2,5-dimethylphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 92868891 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-[(6S)-3-butylsulfanyl-6-(2,5-dimethylphenyl)-8,10-dimethyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]ethanone |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1cc(C)ccc1C)N(C(C)=O)c1c(C)cc(C)cc1-2 |
| InChI | InChI=1S/C26H30N4O2S/c1-7-8-11-33-26-27-24-22(28-29-26)21-14-16(3)12-18(5)23(21)30(19(6)31)25(32-24)20-13-15(2)9-10-17(20)4/h9-10,12-14,25H,7-8,11H2,1-6H3/t25-/m0/s1 |
| InChIKey | QJIUFRGLNFXUHC-VWLOTQADSA-N |
| XLogP | 6.11 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|