C24H24ClFN4O2S — CID 92869342
1-[(6S)-3-butylsulfanyl-10-chloro-6-(4-fluorophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]butan-1-one (PubChem CID 92869342) has the molecular formula C24H24ClFN4O2S and a molecular weight of 487.00 g/mol. Its IUPAC name is 1-[(6S)-3-butylsulfanyl-10-chloro-6-(4-fluorophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]butan-1-one.
| Compound Name | 1-[(6S)-3-butylsulfanyl-10-chloro-6-(4-fluorophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]butan-1-one |
|---|---|
| PubChem CID | 92869342 |
| Molecular Formula | C24H24ClFN4O2S |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 1-[(6S)-3-butylsulfanyl-10-chloro-6-(4-fluorophenyl)-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]butan-1-one |
| SMILES | CCCCSc1nnc2c(n1)O[C@@H](c1ccc(F)cc1)N(C(=O)CCC)c1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C24H24ClFN4O2S/c1-3-5-13-33-24-27-22-21(28-29-24)18-14-16(25)9-12-19(18)30(20(31)6-4-2)23(32-22)15-7-10-17(26)11-8-15/h7-12,14,23H,3-6,13H2,1-2H3/t23-/m0/s1 |
| InChIKey | XYBGBSKQJMTYOD-QHCPKHFHSA-N |
| XLogP | 6.45 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|