C16H18N4O4S — CID 92869539
1-[(2S)-2-methylpiperidin-1-yl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone (PubChem CID 92869539) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[(2S)-2-methylpiperidin-1-yl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-[(2S)-2-methylpiperidin-1-yl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 92869539 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[(2S)-2-methylpiperidin-1-yl]-2-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| SMILES | C[C@H]1CCCCN1C(=O)CSc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H18N4O4S/c1-11-4-2-3-9-19(11)14(21)10-25-16-18-17-15(24-16)12-5-7-13(8-6-12)20(22)23/h5-8,11H,2-4,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | ZIRRMYOOFPZYTG-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|