C17H24N4O6S — CID 92871025
N-(2-methoxyethyl)-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]sulfonyl]piperazine-1-carboxamide (PubChem CID 92871025) has the molecular formula C17H24N4O6S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]sulfonyl]piperazine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]sulfonyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 92871025 |
| Molecular Formula | C17H24N4O6S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(2-methoxyethyl)-4-[[(2R)-2-methyl-3-oxo-4H-1,4-benzoxazin-6-yl]sulfonyl]piperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)[C@@H](C)O3)CC1 |
| InChI | InChI=1S/C17H24N4O6S/c1-12-16(22)19-14-11-13(3-4-15(14)27-12)28(24,25)21-8-6-20(7-9-21)17(23)18-5-10-26-2/h3-4,11-12H,5-10H2,1-2H3,(H,18,23)(H,19,22)/t12-/m1/s1 |
| InChIKey | DZHFVCNVXDRMJW-GFCCVEGCSA-N |
| XLogP | 0.07 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|