C15H17F3N4O2 — CID 92871977
[(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone (PubChem CID 92871977) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is [(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone.
| Compound Name | [(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 92871977 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [(3S,3aS)-3-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydro-3aH-indazol-2-yl]-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCC2)N1N=C2CCCC[C@@H]2[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N4O2/c16-15(17,18)14(24)9-5-1-2-6-11(9)21-22(14)13(23)12-8-4-3-7-10(8)19-20-12/h9,24H,1-7H2,(H,19,20)/t9-,14-/m0/s1 |
| InChIKey | HJIAIMSPSIQKEF-XPTSAGLGSA-N |
| XLogP | 2.15 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |