C22H30N4O4S — CID 92872300
N-[(2S)-butan-2-yl]-3-[(3-methoxyphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide (PubChem CID 92872300) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-3-[(3-methoxyphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide.
| Compound Name | N-[(2S)-butan-2-yl]-3-[(3-methoxyphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 92872300 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[(2S)-butan-2-yl]-3-[(3-methoxyphenyl)sulfonylamino]-4-piperazin-1-ylbenzamide |
| SMILES | CC[C@H](C)NC(=O)c1ccc(N2CCNCC2)c(NS(=O)(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C22H30N4O4S/c1-4-16(2)24-22(27)17-8-9-21(26-12-10-23-11-13-26)20(14-17)25-31(28,29)19-7-5-6-18(15-19)30-3/h5-9,14-16,23,25H,4,10-13H2,1-3H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | XLUACOXXHLFQRL-INIZCTEOSA-N |
| XLogP | 2.43 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |