About 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one
3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one (PubChem CID 92873122) has the molecular formula C25H22N2O2S
and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one |
| PubChem CID | 92873122 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one |
| SMILES | Cc1ccc(C(=O)[C@H](C)Sc2nccn(-c3cccc4ccccc34)c2=O)cc1C |
| InChI | InChI=1S/C25H22N2O2S/c1-16-11-12-20(15-17(16)2)23(28)18(3)30-24-25(29)27(14-13-26-24)22-10-6-8-19-7-4-5-9-21(19)22/h4-15,18H,1-3H3/t18-/m0/s1 |
| InChIKey | FLQAHWZLJDRPNX-SFHVURJKSA-N |
| XLogP | 5.37 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one?
The IUPAC name of 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one (CID 92873122) is 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one.
What is the SMILES notation for 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one?
The canonical SMILES for 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one is Cc1ccc(C(=O)[C@H](C)Sc2nccn(-c3cccc4ccccc34)c2=O)cc1C.
What is the InChIKey of 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one?
The InChIKey is FLQAHWZLJDRPNX-SFHVURJKSA-N. The full InChI is InChI=1S/C25H22N2O2S/c1-16-11-12-20(15-17(16)2)23(28)18(3)30-24-25(29)27(14-13-26-24)22-10-6-8-19-7-4-5-9-21(19)22/h4-15,18H,1-3H3/t18-/m0/s1.
What are the key properties of 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one?
3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one has a molecular weight of 414.53 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]sulfanyl-1-naphthalen-1-ylpyrazin-2-one is sourced from PubChem (CID 92873122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).