C30H26ClN5O — CID 92874621
(9S)-N-(3-chlorophenyl)-5-methyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874621) has the molecular formula C30H26ClN5O and a molecular weight of 508.03 g/mol. Its IUPAC name is (9S)-N-(3-chlorophenyl)-5-methyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-N-(3-chlorophenyl)-5-methyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874621 |
| Molecular Formula | C30H26ClN5O |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (9S)-N-(3-chlorophenyl)-5-methyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1cccc([C@H]2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C30H26ClN5O/c1-20-9-6-10-22(17-20)28-27-15-8-16-34(27)29-26(21(2)33-36(29)25-13-4-3-5-14-25)19-35(28)30(37)32-24-12-7-11-23(31)18-24/h3-18,28H,19H2,1-2H3,(H,32,37)/t28-/m0/s1 |
| InChIKey | PJYLDYDLSRNUAO-NDEPHWFRSA-N |
| XLogP | 7.07 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |