C23H28N4OS — CID 92877305
(3R)-1-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 92877305) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is (3R)-1-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-phenylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92877305 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (3R)-1-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | CCc1cc2c(N3CCC[C@@H](C(=O)NCCCc4ccccc4)C3)ncnc2s1 |
| InChI | InChI=1S/C23H28N4OS/c1-2-19-14-20-21(25-16-26-23(20)29-19)27-13-7-11-18(15-27)22(28)24-12-6-10-17-8-4-3-5-9-17/h3-5,8-9,14,16,18H,2,6-7,10-13,15H2,1H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | WDWGPSQGYQISKF-GOSISDBHSA-N |
| XLogP | 4.22 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|