C21H21N3O4 — CID 92880608
(2S)-2-[4-(4-acetylphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 92880608) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2S)-2-[4-(4-acetylphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2-[4-(4-acetylphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 92880608 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (2S)-2-[4-(4-acetylphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)[C@H]3Oc4ccccc4NC3=O)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(25)15-6-8-16(9-7-15)23-10-12-24(13-11-23)21(27)19-20(26)22-17-4-2-3-5-18(17)28-19/h2-9,19H,10-13H2,1H3,(H,22,26)/t19-/m0/s1 |
| InChIKey | IHVYCPYLOKHEOW-IBGZPJMESA-N |
| XLogP | 1.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|