C20H17BrFN3O3 — CID 92880903
(2R)-N-(4-bromo-3-methylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxypropanamide (PubChem CID 92880903) has the molecular formula C20H17BrFN3O3 and a molecular weight of 446.28 g/mol. Its IUPAC name is (2R)-N-(4-bromo-3-methylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxypropanamide.
| Compound Name | (2R)-N-(4-bromo-3-methylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxypropanamide |
|---|---|
| PubChem CID | 92880903 |
| Molecular Formula | C20H17BrFN3O3 |
| Molecular Weight | 446.28 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | (2R)-N-(4-bromo-3-methylphenyl)-2-[1-(4-fluorophenyl)-6-oxopyridazin-3-yl]oxypropanamide |
| SMILES | Cc1cc(NC(=O)[C@@H](C)Oc2ccc(=O)n(-c3ccc(F)cc3)n2)ccc1Br |
| InChI | InChI=1S/C20H17BrFN3O3/c1-12-11-15(5-8-17(12)21)23-20(27)13(2)28-18-9-10-19(26)25(24-18)16-6-3-14(22)4-7-16/h3-11,13H,1-2H3,(H,23,27)/t13-/m1/s1 |
| InChIKey | AOLXZRYEOOQSEF-CYBMUJFWSA-N |
| XLogP | 3.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |