C22H21N3O3S — CID 92882030
(2R)-N-(3-acetylphenyl)-2-[1-(4-methylphenyl)-6-oxopyridazin-3-yl]sulfanylpropanamide (PubChem CID 92882030) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-[1-(4-methylphenyl)-6-oxopyridazin-3-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-[1-(4-methylphenyl)-6-oxopyridazin-3-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 92882030 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-[1-(4-methylphenyl)-6-oxopyridazin-3-yl]sulfanylpropanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)Sc2ccc(=O)n(-c3ccc(C)cc3)n2)c1 |
| InChI | InChI=1S/C22H21N3O3S/c1-14-7-9-19(10-8-14)25-21(27)12-11-20(24-25)29-16(3)22(28)23-18-6-4-5-17(13-18)15(2)26/h4-13,16H,1-3H3,(H,23,28)/t16-/m1/s1 |
| InChIKey | JTCMVILHXLGLOD-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |