C18H23BrO — CID 92884037
cis-(2R,5S,6Z)-6-[(4-bromophenyl)methylidene]-2,5-dimethyl-2-propan-2-ylcyclohexan-1-one (PubChem CID 92884037) has the molecular formula C18H23BrO and a molecular weight of 335.29 g/mol. Its IUPAC name is cis-(2R,5S,6Z)-6-[(4-bromophenyl)methylidene]-2,5-dimethyl-2-propan-2-ylcyclohexan-1-one.
| Compound Name | cis-(2R,5S,6Z)-6-[(4-bromophenyl)methylidene]-2,5-dimethyl-2-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 92884037 |
| Molecular Formula | C18H23BrO |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | cis-(2R,5S,6Z)-6-[(4-bromophenyl)methylidene]-2,5-dimethyl-2-propan-2-ylcyclohexan-1-one |
| SMILES | CC(C)[C@@]1(C)CC[C@H](C)/C(=C/c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C18H23BrO/c1-12(2)18(4)10-9-13(3)16(17(18)20)11-14-5-7-15(19)8-6-14/h5-8,11-13H,9-10H2,1-4H3/b16-11-/t13-,18+/m0/s1 |
| InChIKey | GRVAQCIAWHSEHI-ROSRMXPWSA-N |
| XLogP | 5.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|