About [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone
[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone (PubChem CID 92884168) has the molecular formula C18H19N3O2
and a molecular weight of 309.37 g/mol. Its IUPAC name is [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone.
Molecular Properties
| Compound Name | [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
| PubChem CID | 92884168 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone |
| SMILES | CC(C)/N=c1\ccccn1C(=O)[C@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C18H19N3O2/c1-13(2)19-17-10-6-7-11-21(17)18(22)16-12-15(20-23-16)14-8-4-3-5-9-14/h3-11,13,16H,12H2,1-2H3/b19-17+/t16-/m1/s1 |
| InChIKey | FDPAPQCBIGDZSO-GWOGKKTRSA-N |
| XLogP | 2.63 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone?
The IUPAC name of [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone (CID 92884168) is [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone.
What is the SMILES notation for [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone?
The canonical SMILES for [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone is CC(C)/N=c1\ccccn1C(=O)[C@H]1CC(c2ccccc2)=NO1.
What is the InChIKey of [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone?
The InChIKey is FDPAPQCBIGDZSO-GWOGKKTRSA-N. The full InChI is InChI=1S/C18H19N3O2/c1-13(2)19-17-10-6-7-11-21(17)18(22)16-12-15(20-23-16)14-8-4-3-5-9-14/h3-11,13,16H,12H2,1-2H3/b19-17+/t16-/m1/s1.
What are the key properties of [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone?
[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone has a molecular weight of 309.37 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-(2-propan-2-ylimino-1-pyridinyl)methanone is sourced from PubChem (CID 92884168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).