C21H23F3N4O2 — CID 9288536
(2R)-N-(3-acetylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide (PubChem CID 9288536) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is (2R)-N-(3-acetylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(3-acetylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9288536 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2R)-N-(3-acetylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)c1 |
| InChI | InChI=1S/C21H23F3N4O2/c1-14(20(30)26-18-5-3-4-16(12-18)15(2)29)27-8-10-28(11-9-27)19-7-6-17(13-25-19)21(22,23)24/h3-7,12-14H,8-11H2,1-2H3,(H,26,30)/t14-/m1/s1 |
| InChIKey | FGZHSKQRADNZIP-CQSZACIVSA-N |
| XLogP | 3.45 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |