C13H11Cl2NO3S2 — CID 92886319
(2E)-2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-oxathiolane (PubChem CID 92886319) has the molecular formula C13H11Cl2NO3S2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (2E)-2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-oxathiolane.
| Compound Name | (2E)-2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-oxathiolane |
|---|---|
| PubChem CID | 92886319 |
| Molecular Formula | C13H11Cl2NO3S2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | (2E)-2-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,3-oxathiolane |
| SMILES | Cc1ccc(SC(=C(Cl)Cl)/C(=C2/OCCS2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H11Cl2NO3S2/c1-8-2-4-9(5-3-8)21-11(12(14)15)10(16(17)18)13-19-6-7-20-13/h2-5H,6-7H2,1H3/b13-10+ |
| InChIKey | SSCNWUYNCDFPFD-JLHYYAGUSA-N |
| XLogP | 4.94 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|