C22H26N2O6S — CID 92888041
4-[(3S)-3-ethoxycarbonylpiperidin-1-yl]-3-[(3-methylphenyl)sulfonylamino]benzoic acid (PubChem CID 92888041) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[(3S)-3-ethoxycarbonylpiperidin-1-yl]-3-[(3-methylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 4-[(3S)-3-ethoxycarbonylpiperidin-1-yl]-3-[(3-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 92888041 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4-[(3S)-3-ethoxycarbonylpiperidin-1-yl]-3-[(3-methylphenyl)sulfonylamino]benzoic acid |
| SMILES | CCOC(=O)[C@H]1CCCN(c2ccc(C(=O)O)cc2NS(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C22H26N2O6S/c1-3-30-22(27)17-7-5-11-24(14-17)20-10-9-16(21(25)26)13-19(20)23-31(28,29)18-8-4-6-15(2)12-18/h4,6,8-10,12-13,17,23H,3,5,7,11,14H2,1-2H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | PSGLNNLOYLPLCG-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |