C27H26FN5O3 — CID 92892459
ethyl 2-[[(9S)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]acetate (PubChem CID 92892459) has the molecular formula C27H26FN5O3 and a molecular weight of 487.54 g/mol. Its IUPAC name is ethyl 2-[[(9S)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(9S)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 92892459 |
| Molecular Formula | C27H26FN5O3 |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | ethyl 2-[[(9S)-9-(3-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1Cc2c(C)nn(-c3ccccc3)c2-n2cccc2[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C27H26FN5O3/c1-3-36-24(34)16-29-27(35)32-17-22-18(2)30-33(21-11-5-4-6-12-21)26(22)31-14-8-13-23(31)25(32)19-9-7-10-20(28)15-19/h4-15,25H,3,16-17H2,1-2H3,(H,29,35)/t25-/m0/s1 |
| InChIKey | JEXYMEOAOOJTEP-VWLOTQADSA-N |
| XLogP | 4.29 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |