C18H24N2O3S — CID 92894039
3-[(2S)-1-(4-ethylphenyl)sulfonylpyrrolidin-2-yl]-5-propyl-1,2-oxazole (PubChem CID 92894039) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[(2S)-1-(4-ethylphenyl)sulfonylpyrrolidin-2-yl]-5-propyl-1,2-oxazole.
| Compound Name | 3-[(2S)-1-(4-ethylphenyl)sulfonylpyrrolidin-2-yl]-5-propyl-1,2-oxazole |
|---|---|
| PubChem CID | 92894039 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[(2S)-1-(4-ethylphenyl)sulfonylpyrrolidin-2-yl]-5-propyl-1,2-oxazole |
| SMILES | CCCc1cc([C@@H]2CCCN2S(=O)(=O)c2ccc(CC)cc2)no1 |
| InChI | InChI=1S/C18H24N2O3S/c1-3-6-15-13-17(19-23-15)18-7-5-12-20(18)24(21,22)16-10-8-14(4-2)9-11-16/h8-11,13,18H,3-7,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | KSANSJMGWRZSJN-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |