C15H18N2O3S — CID 92894119
5-[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]-3-ethyl-1,2-oxazole (PubChem CID 92894119) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]-3-ethyl-1,2-oxazole.
| Compound Name | 5-[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]-3-ethyl-1,2-oxazole |
|---|---|
| PubChem CID | 92894119 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-[(2S)-1-(benzenesulfonyl)pyrrolidin-2-yl]-3-ethyl-1,2-oxazole |
| SMILES | CCc1cc([C@@H]2CCCN2S(=O)(=O)c2ccccc2)on1 |
| InChI | InChI=1S/C15H18N2O3S/c1-2-12-11-15(20-16-12)14-9-6-10-17(14)21(18,19)13-7-4-3-5-8-13/h3-5,7-8,11,14H,2,6,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | HECZWSHBDSDMRS-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |