C23H30N4O3S — CID 92894996
(3R)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide (PubChem CID 92894996) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is (3R)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide.
| Compound Name | (3R)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 92894996 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (3R)-4-(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-N-[3-(N-ethylanilino)propyl]-3-methylbutanamide |
| SMILES | CCN(CCCNC(=O)C[C@H](C)CC1=NS(=O)(=O)c2ccccc2N1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O3S/c1-3-27(19-10-5-4-6-11-19)15-9-14-24-23(28)17-18(2)16-22-25-20-12-7-8-13-21(20)31(29,30)26-22/h4-8,10-13,18H,3,9,14-17H2,1-2H3,(H,24,28)(H,25,26)/t18-/m1/s1 |
| InChIKey | XLBHHBMGNTVVIP-GOSISDBHSA-N |
| XLogP | 3.65 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|