C15H20N2O3 — CID 9289552
[2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 3-amino-4-methylbenzoate (PubChem CID 9289552) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 3-amino-4-methylbenzoate.
| Compound Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 9289552 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [2-[[(1R)-1-cyclopropylethyl]amino]-2-oxoethyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N[C@H](C)C2CC2)cc1N |
| InChI | InChI=1S/C15H20N2O3/c1-9-3-4-12(7-13(9)16)15(19)20-8-14(18)17-10(2)11-5-6-11/h3-4,7,10-11H,5-6,8,16H2,1-2H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | IYWQWAUYJQFISB-SNVBAGLBSA-N |
| XLogP | 1.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|