C23H26N4O4S2 — CID 92896018
(3R)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-carboxamide (PubChem CID 92896018) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (3R)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92896018 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (3R)-1-[4-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-2-yl]sulfonyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidine-3-carboxamide |
| SMILES | Cc1nc(-c2csc(S(=O)(=O)N3CCC[C@@H](C(=O)Nc4cccc5c4CCCC5)C3)c2)no1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-15-24-22(26-31-15)18-12-21(32-14-18)33(29,30)27-11-5-8-17(13-27)23(28)25-20-10-4-7-16-6-2-3-9-19(16)20/h4,7,10,12,14,17H,2-3,5-6,8-9,11,13H2,1H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | HCYKFBPQPLKTEK-QGZVFWFLSA-N |
| XLogP | 4.02 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |