C25H28N4O4 — CID 92896926
ethyl 4-[[2-[4-[(3S)-3-methylpiperidin-1-yl]-2-oxoquinazolin-1-yl]acetyl]amino]benzoate (PubChem CID 92896926) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[(3S)-3-methylpiperidin-1-yl]-2-oxoquinazolin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[(3S)-3-methylpiperidin-1-yl]-2-oxoquinazolin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 92896926 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | ethyl 4-[[2-[4-[(3S)-3-methylpiperidin-1-yl]-2-oxoquinazolin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c(=O)nc(N3CCC[C@H](C)C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H28N4O4/c1-3-33-24(31)18-10-12-19(13-11-18)26-22(30)16-29-21-9-5-4-8-20(21)23(27-25(29)32)28-14-6-7-17(2)15-28/h4-5,8-13,17H,3,6-7,14-16H2,1-2H3,(H,26,30)/t17-/m0/s1 |
| InChIKey | KNWNBWLYANWFIR-KRWDZBQOSA-N |
| XLogP | 3.45 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |