C25H32N4O3S — CID 92899273
(3R)-1-[3-(4-methylphenyl)-4-oxothieno[3,2-d]pyrimidin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide (PubChem CID 92899273) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is (3R)-1-[3-(4-methylphenyl)-4-oxothieno[3,2-d]pyrimidin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-(4-methylphenyl)-4-oxothieno[3,2-d]pyrimidin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92899273 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (3R)-1-[3-(4-methylphenyl)-4-oxothieno[3,2-d]pyrimidin-2-yl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(-n2c(N3CCC[C@@H](C(=O)NCCCOC(C)C)C3)nc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c1-17(2)32-14-5-12-26-23(30)19-6-4-13-28(16-19)25-27-21-11-15-33-22(21)24(31)29(25)20-9-7-18(3)8-10-20/h7-11,15,17,19H,4-6,12-14,16H2,1-3H3,(H,26,30)/t19-/m1/s1 |
| InChIKey | BTAOHLYIOMRYAV-LJQANCHMSA-N |
| XLogP | 3.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|