C26H24N2O3S — CID 92901444
(11S)-5-ethyl-6,11-dioxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 92901444) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is (11S)-5-ethyl-6,11-dioxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | (11S)-5-ethyl-6,11-dioxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 92901444 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (11S)-5-ethyl-6,11-dioxo-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCN1C(=O)c2ccccc2[S@](=O)c2ccc(C(=O)N[C@@H]3CCCc4ccccc43)cc21 |
| InChI | InChI=1S/C26H24N2O3S/c1-2-28-22-16-18(25(29)27-21-12-7-9-17-8-3-4-10-19(17)21)14-15-24(22)32(31)23-13-6-5-11-20(23)26(28)30/h3-6,8,10-11,13-16,21H,2,7,9,12H2,1H3,(H,27,29)/t21-,32+/m1/s1 |
| InChIKey | KRSCSLBMHMDHNJ-KTBRYMIGSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |