C12H11F12NO4 — CID 92905108
N-[2-[[(4S)-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide (PubChem CID 92905108) has the molecular formula C12H11F12NO4 and a molecular weight of 461.20 g/mol. Its IUPAC name is N-[2-[[(4S)-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide.
| Compound Name | N-[2-[[(4S)-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide |
|---|---|
| PubChem CID | 92905108 |
| Molecular Formula | C12H11F12NO4 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[2-[[(4S)-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide |
| SMILES | CCC(=O)NC(OC[C@H]1COC(C(F)(F)F)(C(F)(F)F)O1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F12NO4/c1-2-6(26)25-7(9(13,14)15,10(16,17)18)27-3-5-4-28-8(29-5,11(19,20)21)12(22,23)24/h5H,2-4H2,1H3,(H,25,26)/t5-/m0/s1 |
| InChIKey | ICBZFGYKQNGGOK-YFKPBYRVSA-N |
| XLogP | 3.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|