C35H30N2O4 — CID 92905381
(15S,19R)-17-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)iminomethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 92905381) has the molecular formula C35H30N2O4 and a molecular weight of 542.64 g/mol. Its IUPAC name is (15S,19R)-17-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)iminomethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)iminomethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 92905381 |
| Molecular Formula | C35H30N2O4 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (15S,19R)-17-(4-ethoxyphenyl)-1-[(4-ethoxyphenyl)iminomethyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCOc1ccc(/N=C/C23c4ccccc4C(c4ccccc42)[C@H]2C(=O)N(c4ccc(OCC)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C35H30N2O4/c1-3-40-24-17-13-22(14-18-24)36-21-35-28-11-7-5-9-26(28)30(27-10-6-8-12-29(27)35)31-32(35)34(39)37(33(31)38)23-15-19-25(20-16-23)41-4-2/h5-21,30-32H,3-4H2,1-2H3/b36-21+/t30?,31-,32-,35?/m1/s1 |
| InChIKey | SNZMYKOCJBYYBR-RRGMHWAFSA-N |
| XLogP | 6.44 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|