C27H30FN5O6 — CID 92906062
(6S)-6-N-[(4-fluorophenyl)methyl]-5,6-dimethyl-4-oxo-2-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide (PubChem CID 92906062) has the molecular formula C27H30FN5O6 and a molecular weight of 539.56 g/mol. Its IUPAC name is (6S)-6-N-[(4-fluorophenyl)methyl]-5,6-dimethyl-4-oxo-2-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide.
| Compound Name | (6S)-6-N-[(4-fluorophenyl)methyl]-5,6-dimethyl-4-oxo-2-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 92906062 |
| Molecular Formula | C27H30FN5O6 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (6S)-6-N-[(4-fluorophenyl)methyl]-5,6-dimethyl-4-oxo-2-N-[(3,4,5-trimethoxyphenyl)methyl]-7H-pyrazolo[1,5-a]pyrazine-2,6-dicarboxamide |
| SMILES | COc1cc(CNC(=O)c2cc3n(n2)C[C@@](C)(C(=O)NCc2ccc(F)cc2)N(C)C3=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H30FN5O6/c1-27(26(36)30-13-16-6-8-18(28)9-7-16)15-33-20(25(35)32(27)2)12-19(31-33)24(34)29-14-17-10-21(37-3)23(39-5)22(11-17)38-4/h6-12H,13-15H2,1-5H3,(H,29,34)(H,30,36)/t27-/m0/s1 |
| InChIKey | PFMOFDUQIHUEDD-MHZLTWQESA-N |
| XLogP | 2.14 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |