C18H14Cl2O — CID 92909334
(Z)-3-[4-[(1S)-2,2-dichlorocyclopropyl]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 92909334) has the molecular formula C18H14Cl2O and a molecular weight of 317.22 g/mol. Its IUPAC name is (Z)-3-[4-[(1S)-2,2-dichlorocyclopropyl]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (Z)-3-[4-[(1S)-2,2-dichlorocyclopropyl]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 92909334 |
| Molecular Formula | C18H14Cl2O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (Z)-3-[4-[(1S)-2,2-dichlorocyclopropyl]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccc([C@@H]2CC2(Cl)Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H14Cl2O/c19-18(20)12-16(18)14-9-6-13(7-10-14)8-11-17(21)15-4-2-1-3-5-15/h1-11,16H,12H2/b11-8-/t16-/m0/s1 |
| InChIKey | SZULUGHAPLIYLO-CLOOOTJHSA-N |
| XLogP | 5.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|