C24H25N5O2S2 — CID 92909848
5-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile (PubChem CID 92909848) has the molecular formula C24H25N5O2S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 5-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 92909848 |
| Molecular Formula | C24H25N5O2S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 5-[(E)-(3-benzyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-6-(4-methylpiperazin-1-yl)-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=C2/SC(=S)N(Cc3ccccc3)C2=O)c(N2CCN(C)CC2)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C24H25N5O2S2/c1-16-18(13-20-23(31)29(24(32)33-20)15-17-7-5-4-6-8-17)21(27(3)22(30)19(16)14-25)28-11-9-26(2)10-12-28/h4-8,13H,9-12,15H2,1-3H3/b20-13+ |
| InChIKey | TXEWORUBDXCKLW-DEDYPNTBSA-N |
| XLogP | 2.72 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|