C10H12ClNO — CID 9291148
2-chloro-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 9291148) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 2-chloro-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9291148 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-chloro-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)CCl |
| InChI | InChI=1S/C10H12ClNO/c1-8-4-2-3-5-9(8)7-12-10(13)6-11/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | CLEDDHAOOOPHJM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|