C19H16IN3O2 — CID 92911756
(Z)-2-(1H-benzimidazol-2-yl)-3-(3-ethoxy-5-iodo-4-methoxyphenyl)prop-2-enenitrile (PubChem CID 92911756) has the molecular formula C19H16IN3O2 and a molecular weight of 445.26 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-(3-ethoxy-5-iodo-4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-ethoxy-5-iodo-4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 92911756 |
| Molecular Formula | C19H16IN3O2 |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-(3-ethoxy-5-iodo-4-methoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccccc3[nH]2)cc(I)c1OC |
| InChI | InChI=1S/C19H16IN3O2/c1-3-25-17-10-12(9-14(20)18(17)24-2)8-13(11-21)19-22-15-6-4-5-7-16(15)23-19/h4-10H,3H2,1-2H3,(H,22,23)/b13-8- |
| InChIKey | YEEWKUFAERVWAZ-JYRVWZFOSA-N |
| XLogP | 4.64 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|