C22H21N3O — CID 92912504
2-[(Z)-2-(1,2-dimethylindol-3-yl)ethenyl]-3-ethylquinazolin-4-one (PubChem CID 92912504) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[(Z)-2-(1,2-dimethylindol-3-yl)ethenyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[(Z)-2-(1,2-dimethylindol-3-yl)ethenyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 92912504 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 2-[(Z)-2-(1,2-dimethylindol-3-yl)ethenyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(/C=C\c2c(C)n(C)c3ccccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H21N3O/c1-4-25-21(23-19-11-7-5-10-18(19)22(25)26)14-13-16-15(2)24(3)20-12-8-6-9-17(16)20/h5-14H,4H2,1-3H3/b14-13- |
| InChIKey | YAQDUTBXTZQHJG-YPKPFQOOSA-N |
| XLogP | 4.39 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|