C16H19N3O2S3 — CID 9291586
1,3,5-trimethyl-N,N-bis(thiophen-2-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 9291586) has the molecular formula C16H19N3O2S3 and a molecular weight of 381.55 g/mol. Its IUPAC name is 1,3,5-trimethyl-N,N-bis(thiophen-2-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 1,3,5-trimethyl-N,N-bis(thiophen-2-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 9291586 |
| Molecular Formula | C16H19N3O2S3 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1,3,5-trimethyl-N,N-bis(thiophen-2-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C16H19N3O2S3/c1-12-16(13(2)18(3)17-12)24(20,21)19(10-14-6-4-8-22-14)11-15-7-5-9-23-15/h4-9H,10-11H2,1-3H3 |
| InChIKey | LPZWGDGNZLPJDZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |