C20H27NO2 — CID 92927972
N-[[3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]ethanamine (PubChem CID 92927972) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[[3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 92927972 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-[[3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(OCCOc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C20H27NO2/c1-5-21-14-18-7-6-8-19(13-18)22-9-10-23-20-12-15(2)11-16(3)17(20)4/h6-8,11-13,21H,5,9-10,14H2,1-4H3 |
| InChIKey | VAYDEWSUEOALIV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|