C19H17NO6 — CID 9292874
4-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 9292874) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 4-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 9292874 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-O-methyl 2-O-(4-methyl-2-oxochromen-7-yl) 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)Oc2ccc3c(C)cc(=O)oc3c2)c1C |
| InChI | InChI=1S/C19H17NO6/c1-9-7-15(21)26-14-8-12(5-6-13(9)14)25-19(23)17-10(2)16(11(3)20-17)18(22)24-4/h5-8,20H,1-4H3 |
| InChIKey | RCRPIWUAQNFXDQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|