C17H18FN3O2 — CID 92944450
3-amino-N-[5-fluoro-2-[(2-phenylacetyl)amino]phenyl]propanamide (PubChem CID 92944450) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-amino-N-[5-fluoro-2-[(2-phenylacetyl)amino]phenyl]propanamide.
| Compound Name | 3-amino-N-[5-fluoro-2-[(2-phenylacetyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 92944450 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-amino-N-[5-fluoro-2-[(2-phenylacetyl)amino]phenyl]propanamide |
| SMILES | NCCC(=O)Nc1cc(F)ccc1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H18FN3O2/c18-13-6-7-14(15(11-13)21-16(22)8-9-19)20-17(23)10-12-4-2-1-3-5-12/h1-7,11H,8-10,19H2,(H,20,23)(H,21,22) |
| InChIKey | RAWXWRKDELHLOK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |