C29H31N3OS — CID 92948469
[4-[[(2S,3R,4R)-2-ethyl-3-methyl-1-(4-propan-2-ylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]amino]phenyl] thiocyanate (PubChem CID 92948469) has the molecular formula C29H31N3OS and a molecular weight of 469.65 g/mol. Its IUPAC name is [4-[[(2S,3R,4R)-2-ethyl-3-methyl-1-(4-propan-2-ylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[(2S,3R,4R)-2-ethyl-3-methyl-1-(4-propan-2-ylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 92948469 |
| Molecular Formula | C29H31N3OS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | [4-[[(2S,3R,4R)-2-ethyl-3-methyl-1-(4-propan-2-ylbenzoyl)-3,4-dihydro-2H-quinolin-4-yl]amino]phenyl] thiocyanate |
| SMILES | CC[C@H]1[C@H](C)[C@@H](Nc2ccc(SC#N)cc2)c2ccccc2N1C(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C29H31N3OS/c1-5-26-20(4)28(31-23-14-16-24(17-15-23)34-18-30)25-8-6-7-9-27(25)32(26)29(33)22-12-10-21(11-13-22)19(2)3/h6-17,19-20,26,28,31H,5H2,1-4H3/t20-,26-,28+/m0/s1 |
| InChIKey | HCLBIUVDGKKIDF-IYKJZBSOSA-N |
| XLogP | 7.61 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|