About N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine
N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine (PubChem CID 929489) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine |
| PubChem CID | 929489 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine |
| SMILES | CC(C)(C)Nc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C11H13N3O3/c1-11(2,3)13-10-12-8-5-4-7(14(15)16)6-9(8)17-10/h4-6H,1-3H3,(H,12,13) |
| InChIKey | OWKMZBHWVPETHV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine?
The IUPAC name of N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine (CID 929489) is N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine.
What is the SMILES notation for N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine?
The canonical SMILES for N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine is CC(C)(C)Nc1nc2ccc([N+](=O)[O-])cc2o1.
What is the InChIKey of N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine?
The InChIKey is OWKMZBHWVPETHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-11(2,3)13-10-12-8-5-4-7(14(15)16)6-9(8)17-10/h4-6H,1-3H3,(H,12,13).
What are the key properties of N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine?
N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine has a molecular weight of 235.24 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-6-nitro-1,3-benzoxazol-2-amine is sourced from PubChem (CID 929489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).