About (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine
(2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine (PubChem CID 92953665) has the molecular formula C9H18BrN
and a molecular weight of 220.15 g/mol. Its IUPAC name is (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine |
| PubChem CID | 92953665 |
| Molecular Formula | C9H18BrN |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine |
| SMILES | C[C@H]1CC[C@H](C)N1CCCBr |
| InChI | InChI=1S/C9H18BrN/c1-8-4-5-9(2)11(8)7-3-6-10/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | ORHLQGXHGDUTKI-IUCAKERBSA-N |
| XLogP | 2.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine?
The IUPAC name of (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine (CID 92953665) is (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine.
What is the SMILES notation for (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine?
The canonical SMILES for (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine is C[C@H]1CC[C@H](C)N1CCCBr.
What is the InChIKey of (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine?
The InChIKey is ORHLQGXHGDUTKI-IUCAKERBSA-N. The full InChI is InChI=1S/C9H18BrN/c1-8-4-5-9(2)11(8)7-3-6-10/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine?
(2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine has a molecular weight of 220.15 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-1-(3-bromopropyl)-2,5-dimethylpyrrolidine is sourced from PubChem (CID 92953665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).