C25H28ClNO4S2 — CID 92955534
(5Z)-5-[[3-chloro-4-[3-(2,3-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 92955534) has the molecular formula C25H28ClNO4S2 and a molecular weight of 506.09 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-4-[3-(2,3-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-chloro-4-[3-(2,3-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 92955534 |
| Molecular Formula | C25H28ClNO4S2 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (5Z)-5-[[3-chloro-4-[3-(2,3-dimethylphenoxy)propoxy]-5-ethoxyphenyl]methylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(CC)C2=O)cc(Cl)c1OCCCOc1cccc(C)c1C |
| InChI | InChI=1S/C25H28ClNO4S2/c1-5-27-24(28)22(33-25(27)32)15-18-13-19(26)23(21(14-18)29-6-2)31-12-8-11-30-20-10-7-9-16(3)17(20)4/h7,9-10,13-15H,5-6,8,11-12H2,1-4H3/b22-15- |
| InChIKey | AJHHPJNPQOFHGV-JCMHNJIXSA-N |
| XLogP | 6.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|