C7H7N5S3 — CID 9295625
4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295625) has the molecular formula C7H7N5S3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295625 |
| Molecular Formula | C7H7N5S3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 4-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | Cc1nc(/C=N\n2c(=S)[nH][nH]c2=S)cs1 |
| InChI | InChI=1S/C7H7N5S3/c1-4-9-5(3-15-4)2-8-12-6(13)10-11-7(12)14/h2-3H,1H3,(H,10,13)(H,11,14)/b8-2- |
| InChIKey | MHMMCDHDWUGVQO-WAPJZHGLSA-N |
| XLogP | 2.25 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|