C24H29NO3 — CID 9295714
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-methoxy-4-phenylmethoxyphenyl)methanone (PubChem CID 9295714) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-methoxy-4-phenylmethoxyphenyl)methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-methoxy-4-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 9295714 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-(3-methoxy-4-phenylmethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CC[C@@H]3CCCC[C@@H]3C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H29NO3/c1-27-23-15-20(11-12-22(23)28-17-18-7-3-2-4-8-18)24(26)25-14-13-19-9-5-6-10-21(19)16-25/h2-4,7-8,11-12,15,19,21H,5-6,9-10,13-14,16-17H2,1H3/t19-,21+/m0/s1 |
| InChIKey | DTMOQFBRVRHVMC-PZJWPPBQSA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |